For research use only. Not for therapeutic Use.
CRT5 (Cat No.: I011748) is a peptide-based compound that has been investigated for its potential immunotherapeutic properties. It targets cancer cells by interacting with specific cell surface receptors, which helps to stimulate the immune system and enhance its ability to recognize and destroy tumor cells. CRT5 has shown promise in preclinical studies, particularly for treating cancers resistant to traditional therapies. By modulating immune responses, it may improve treatment outcomes in various malignancies, though further clinical trials are required to confirm its efficacy and safety.
CAS Number | 1034297-58-9 |
Synonyms | 3-[6-amino-5-(6-ethoxy-2-naphthalenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]-benzamide |
Molecular Formula | C28H30N4O2 |
Purity | ≥95% |
Target | PKD |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 3-[6-amino-5-(6-ethoxynaphthalen-2-yl)pyridin-3-yl]-N-[2-(dimethylamino)ethyl]benzamide |
InChI | InChI=1S/C28H30N4O2/c1-4-34-25-11-10-20-14-22(9-8-21(20)16-25)26-17-24(18-31-27(26)29)19-6-5-7-23(15-19)28(33)30-12-13-32(2)3/h5-11,14-18H,4,12-13H2,1-3H3,(H2,29,31)(H,30,33) |
InChIKey | XBDRAUPLGHAFCU-UHFFFAOYSA-N |
SMILES | CCOC1=CC2=C(C=C1)C=C(C=C2)C3=C(N=CC(=C3)C4=CC(=CC=C4)C(=O)NCCN(C)C)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |