For research use only. Not for therapeutic Use.
Cryptomeridiol is a natural diterpenoid compound isolated from various plant species, including Cryptomeria japonica. It exhibits potential pharmacological activities, such as anti-inflammatory and antitumor effects, making it a subject of interest in medicinal chemistry. Research on cryptomeridiol focuses on its biological properties, mechanisms of action, and therapeutic potential in treating inflammatory conditions and cancer. Additionally, studies explore its synthesis and modifications to develop novel derivatives with improved pharmacological profiles for therapeutic applications.
| Catalog Number | R048605 |
| CAS Number | 4666-84-6 |
| Molecular Formula | C15H28O2 |
| Purity | ≥95% |
| Target | Plants |
| Storage | -20 ℃ |
| IUPAC Name | (1R,4aR,7R,8aR)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol |
| InChI | InChI=1S/C15H28O2/c1-13(2,16)11-6-9-14(3)7-5-8-15(4,17)12(14)10-11/h11-12,16-17H,5-10H2,1-4H3/t11-,12-,14-,15-/m1/s1 |
| InChIKey | LKKDASYGWYYFIK-QHSBEEBCSA-N |
| SMILES | CC12CCCC(C1CC(CC2)C(C)(C)O)(C)O |
