For research use only. Not for therapeutic Use.
Cryptotanshinone (Cat No.:I003313) is a natural bioactive compound derived from the roots of Salvia miltiorrhiza. It possesses diverse pharmacological properties, including anti-inflammatory, antioxidant, anticancer, and cardioprotective effects. Cryptotanshinone has demonstrated inhibitory activity against cancer cell growth and proliferation, making it a potential candidate for cancer treatment. It also exhibits anti-inflammatory properties by modulating signaling pathways involved in inflammation.
| Catalog Number | I003313 |
| CAS Number | 35825-57-1 |
| Synonyms | (1R)-1,6,6-trimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| Molecular Formula | C₁₉H₂₀O₃ |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | DMSO: ≥ 5 mg/mL |
| Storage | -20 ℃ |
| IC50 | 4.6 uM |
| IUPAC Name | (1R)-1,6,6-trimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| InChI | InChI=1S/C19H20O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | GVKKJJOMQCNPGB-JTQLQIEISA-N |
| SMILES | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C |
