Crystal Violet（Cat No.:A001125）is a triarylmethane dye widely used in histology and microbiology for staining cells, tissues, and bacterial samples. Known for its vibrant violet hue, it binds to cell wall components, highlighting cellular structures under the microscope. Crystal Violet is essential in Gram staining to differentiate between Gram-positive and Gram-negative bacteria. Beyond its staining applications, it exhibits antimicrobial properties, making it useful in medical and laboratory settings. High-purity Crystal Violet ensures accurate, reliable results in various biological and clinical research applications, contributing to advancements in diagnostic techniques.
| Catalog Number | A001125 |
| CAS Number | 548-62-9 |
| Synonyms | NA |
| Molecular Formula | C25H30ClN3 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride |
| InChI | InChI=1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1 |
| InChIKey | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] |
