For research use only. Not for therapeutic Use.
CS640（Cat No.:I041097）is a small molecule compound under investigation for its potential therapeutic applications, particularly in oncology and neurodegenerative diseases. It works by targeting specific signaling pathways involved in cell proliferation, apoptosis, and neuroinflammation. CS640 has shown promise in preclinical studies for inhibiting the growth of various cancer cells, as well as modulating immune responses in neurodegenerative conditions. Its mechanism of action suggests potential applications in treating tumors resistant to conventional therapies and offering neuroprotective effects. CS640 is being explored for its ability to provide targeted treatment in complex diseases.
| CAS Number | 2388506-83-8 |
| Synonyms | 2-[(3S)-3-aminopiperidin-1-yl]-4-[[2,6-di(propan-2-yl)pyridin-4-yl]amino]pyrimidine-5-carboxamide |
| Molecular Formula | C21H31N7O |
| Purity | ≥95% |
| IUPAC Name | 2-[(3S)-3-aminopiperidin-1-yl]-4-[[2,6-di(propan-2-yl)pyridin-4-yl]amino]pyrimidine-5-carboxamide |
| InChI | InChI=1S/C21H31N7O/c1-12(2)17-8-15(9-18(26-17)13(3)4)25-20-16(19(23)29)10-24-21(27-20)28-7-5-6-14(22)11-28/h8-10,12-14H,5-7,11,22H2,1-4H3,(H2,23,29)(H,24,25,26,27)/t14-/m0/s1 |
| InChIKey | BWBUPDTUXQDHSX-AWEZNQCLSA-N |
| SMILES | CC(C)C1=CC(=CC(=N1)C(C)C)NC2=NC(=NC=C2C(=O)N)N3CCC[C@@H](C3)N |
