For research use only. Not for therapeutic Use.
CSNK1-IN-1（Cat No.:I042313）is a small molecule inhibitor that targets casein kinase 1 (CK1), a family of enzymes involved in regulating several critical cellular processes, such as the cell cycle, circadian rhythms, and signaling pathways related to growth and survival. By inhibiting CK1, CSNK1-IN-1 aims to modulate these processes, making it a potential therapeutic candidate for diseases associated with CK1 dysregulation, including certain cancers and neurodegenerative conditions. Preclinical studies suggest its potential in disrupting abnormal cell functions.
| Catalog Number | I042313 |
| CAS Number | 2468784-55-4 |
| Synonyms | (2R)-N-[4-(3-anilino-5-methyl-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl)pyridin-2-yl]-4,4-difluoro-2-(4-fluorophenyl)butanamide |
| Molecular Formula | C29H26F3N5O2 |
| Purity | ≥95% |
| IUPAC Name | (2R)-N-[4-(3-anilino-5-methyl-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl)pyridin-2-yl]-4,4-difluoro-2-(4-fluorophenyl)butanamide |
| InChI | InChI=1S/C29H26F3N5O2/c1-37-14-12-22-25(29(37)39)27(34-20-5-3-2-4-6-20)26(35-22)18-11-13-33-24(15-18)36-28(38)21(16-23(31)32)17-7-9-19(30)10-8-17/h2-11,13,15,21,23,34-35H,12,14,16H2,1H3,(H,33,36,38)/t21-/m1/s1 |
| InChIKey | IKATWWUGCJFQJV-OAQYLSRUSA-N |
| SMILES | CN1CCC2=C(C1=O)C(=C(N2)C3=CC(=NC=C3)NC(=O)[C@H](CC(F)F)C4=CC=C(C=C4)F)NC5=CC=CC=C5 |
