For research use only. Not for therapeutic Use.
CSNK1-IN-2(Cat No.:I042312)is a small molecule inhibitor designed to target casein kinase 1 (CK1), an enzyme involved in regulating various cellular processes, including cell division, circadian rhythms, and DNA repair. By inhibiting CK1, CSNK1-IN-2 aims to modulate key signaling pathways that are dysregulated in conditions such as cancer, neurodegenerative diseases, and inflammatory disorders. The compound has shown promise in preclinical studies for its ability to disrupt abnormal cell signaling, potentially offering therapeutic benefits in treating diseases where CK1 is implicated. Ongoing research is focused on assessing its safety, efficacy, and therapeutic potential in clinical settings.
CAS Number | 2468783-76-6 |
Synonyms | (2R)-N-[4-(3-anilino-5-methyl-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl)pyridin-2-yl]-2-(4-fluorophenyl)propanamide |
Molecular Formula | C28H26FN5O2 |
Purity | ≥95% |
IUPAC Name | (2R)-N-[4-(3-anilino-5-methyl-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl)pyridin-2-yl]-2-(4-fluorophenyl)propanamide |
InChI | InChI=1S/C28H26FN5O2/c1-17(18-8-10-20(29)11-9-18)27(35)33-23-16-19(12-14-30-23)25-26(31-21-6-4-3-5-7-21)24-22(32-25)13-15-34(2)28(24)36/h3-12,14,16-17,31-32H,13,15H2,1-2H3,(H,30,33,35)/t17-/m1/s1 |
InChIKey | UYAQWCZWVIFRCN-QGZVFWFLSA-N |
SMILES | C[C@H](C1=CC=C(C=C1)F)C(=O)NC2=NC=CC(=C2)C3=C(C4=C(N3)CCN(C4=O)C)NC5=CC=CC=C5 |