For research use only. Not for therapeutic Use.
CTX-0124143 is a synthetic compound that has garnered interest in pharmacological research due to its potential therapeutic applications. Designed as a selective modulator, it targets specific biological pathways, which may lead to beneficial effects in treating various diseases. Its unique chemical structure enhances its efficacy and minimizes side effects, making it a promising candidate in drug development. Ongoing studies aim to explore its pharmacokinetics, mechanisms of action, and overall impact, contributing to the advancement of targeted therapies in modern medicine.
CAS Number | 423731-64-0 |
Synonyms | CTX-0124143; CTX 0124143; CTX0124143; |
Molecular Formula | C17H13FN2O3S |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | N'-(2-fluorobenzoyl)naphthalene-2-sulfonohydrazide |
InChI | InChI=1S/C17H13FN2O3S/c18-16-8-4-3-7-15(16)17(21)19-20-24(22,23)14-10-9-12-5-1-2-6-13(12)11-14/h1-11,20H,(H,19,21) |
InChIKey | CMGWGSMHPCWLOH-UHFFFAOYSA-N |
SMILES | O=S(C1=CC=C2C=CC=CC2=C1)(NNC(C3=CC=CC=C3F)=O)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |