For research use only. Not for therapeutic Use.
Cuban-1-ylmethanol (Cat.No:L004136) is a significant compound in organic synthesis. Its distinctive structure, featuring a cubane ring, imparts unique reactivity and properties. This compound serves as a valuable building block in the creation of specialized molecules with various potential applications in pharmaceutical and chemical research.
Catalog Number | L004136 |
CAS Number | 134078-23-2 |
Molecular Formula | C9H10O |
Purity | ≥95% |
IUPAC Name | cuban-1-ylmethanol |
InChI | InChI=1S/C9H10O/c10-1-9-6-3-2-4(6)8(9)5(2)7(3)9/h2-8,10H,1H2 |
InChIKey | SHBYTOJQOCOSPG-UHFFFAOYSA-N |
SMILES | C(C12C3C4C1C5C4C3C25)O |