For research use only. Not for therapeutic Use.
Cucurbitacin D(Cat No.:I018560)is a bioactive triterpenoid compound found in various plants, particularly in the Cucurbitaceae family, which includes cucumbers and melons. It is known for its potent anti-inflammatory, anticancer, and antioxidant properties. Cucurbitacin D exerts its effects by inhibiting key signaling pathways such as JAK/STAT, which are involved in cell proliferation, survival, and inflammation. Preclinical studies suggest that it may suppress tumor growth, induce apoptosis in cancer cells, and reduce inflammatory responses. Due to these promising properties, cucurbitacin D is being explored as a potential therapeutic agent in cancer and inflammatory diseases.
Catalog Number | I018560 |
CAS Number | 3877-86-9 |
Molecular Formula | C₃₀H₄₄O₇ |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | (2S,8S,9R,10R,13R,14S,16R,17R)-17-[(E,2R)-2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl]-2,16-dihydroxy-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
InChI | InChI=1S/C30H44O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-12,17-20,23,31-32,36-37H,10,13-15H2,1-8H3/b12-11+/t17-,18+,19-,20+,23+,27+,28-,29+,30+/m1/s1 |
InChIKey | SRPHMISUTWFFKJ-QJNWWGCFSA-N |
SMILES | C[C@@]12C[C@H]([C@@H]([C@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@H]3C[C@@H](C(=O)C4(C)C)O)C)C)[C@](C)(C(=O)/C=C/C(C)(C)O)O)O |