For research use only. Not for therapeutic Use.
CUDA(CAT: I011631) is a small molecule inhibitor of the enzyme phosphodiesterase 5 (PDE5), which is involved in the degradation of cyclic guanosine monophosphate (cGMP), a signaling molecule that regulates various physiological processes. By inhibiting PDE5, CUDA increases the levels of cGMP, leading to the relaxation of smooth muscle cells in blood vessels and other tissues. This property of CUDA has led to its use in research and the development of pharmaceuticals for the treatment of erectile dysfunction and pulmonary arterial hypertension.
| Catalog Number | I011631 |
| CAS Number | 479413-68-8 |
| Synonyms | 12-[[(cyclohexylamino)carbonyl]amino]-dodecanoic acid |
| Molecular Formula | C19H36N2O3 |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 12-(cyclohexylcarbamoylamino)dodecanoic acid |
| InChI | InChI=1S/C19H36N2O3/c22-18(23)15-11-6-4-2-1-3-5-7-12-16-20-19(24)21-17-13-9-8-10-14-17/h17H,1-16H2,(H,22,23)(H2,20,21,24) |
| InChIKey | HPTJABJPZMULFH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)NCCCCCCCCCCCC(=O)O |
