For research use only. Not for therapeutic Use.
Cumene is a high-purity aromatic hydrocarbon used extensively in organic synthesis and industrial applications. This important chemical intermediate is essential for producing phenol and acetone through the cumene process, and for studying hydrocarbon reactions. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical manufacturing and material science applications. Ideal for experimental setups, cumene enhances research accuracy and efficiency.
| Catalog Number | R023518 |
| CAS Number | 98-82-8 |
| Synonyms | (1-Methylethyl)benzene; 2-Phenylpropane; Cumol; Isopropylbenzene; NSC 8776; i-Propylbenzene; |
| Molecular Formula | C9H12 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | cumene |
| InChI | InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | RWGFKTVRMDUZSP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC=C1 |
