For research use only. Not for therapeutic Use.
Cupric carbonate(Cat No.:M051213), also known as copper(II) carbonate, is a chemical compound. It typically appears as a green powder and is not found as a pure mineral but rather in combination with other elements such as hydroxide forming malachite or azurite. Cupric carbonate is used in various industrial applications, including as a pigment in ceramics to create green and blue glazes, and in paints. Additionally, it serves as a precursor in the preparation of other copper compounds used in agriculture and chemistry, and as a wood preservative.
CAS Number | 1184-64-1 |
Molecular Formula | CuCO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | copper;carbonate |
InChI | InChI=1S/CH2O3.Cu/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
InChIKey | GEZOTWYUIKXWOA-UHFFFAOYSA-L |
SMILES | C(=O)([O-])[O-].[Cu+2] |