For research use only. Not for therapeutic Use.
Curcumin, Curcuma longa (Cat No.:A001131) is a natural polyphenol extracted from turmeric, renowned for its potent antioxidant, anti-inflammatory, and anti-cancer properties. Widely used in pharmaceutical and nutraceutical industries, curcumin supports various therapeutic applications, including managing chronic inflammatory diseases, promoting cardiovascular health, and enhancing cognitive function. Its bioavailability is a focus of ongoing research to maximize its therapeutic potential. High-purity curcumin ensures consistency and efficacy in formulations, making it a valuable component in both traditional and modern medical practices, contributing to overall health and wellness.
| Catalog Number | A001131 |
| CAS Number | 458-37-7 |
| Synonyms | Diferuloylmethane |
| Molecular Formula | C₂₁H₂₀O₆ |
| Purity | ≥95% |
| Target | KEAP1-Nrf2 |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | 3 years -20C powder |
| IUPAC Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| InChI | InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ |
| InChIKey | VFLDPWHFBUODDF-FCXRPNKRSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O |
