For research use only. Not for therapeutic Use.
Curcumol (CAT: I003718) is a natural sesquiterpene compound derived from Curcuma species, such as Curcuma zedoaria. It possesses various pharmacological activities and has been studied for its potential therapeutic applications. Curcumol exhibits anti-inflammatory, antioxidant, anticancer, and neuroprotective properties. It has shown promise in inhibiting inflammatory pathways, scavenging free radicals, suppressing tumor cell growth, and protecting against neurological disorders. Additionally, curcumol has been investigated for its antimicrobial activity against certain bacteria and fungi. While further research is needed, curcumol holds potential as a natural compound with diverse pharmacological properties and possible applications in various fields, including medicine and drug development.
CAS Number | 4871-97-0 |
Molecular Formula | C15H24O2 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 10 mM in DMSO |
Storage | store at -20℃ |
IUPAC Name | (1S,2S,5S,8R,9S)-2-methyl-6-methylidene-9-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undecan-8-ol |
InChI | 1S/C15H24O2/c1-9(2)13-8-14-11(4)5-6-12(14)10(3)7-15(13,16)17-14/h9,11-13,16H,3,5-8H2,1-2,4H3/t11-,12-,13-,14-,15+/m0/s1 |
InChIKey | QRMPRVXWPCLVNI-YYFQZIEXSA-N |
SMILES | C[C@H]1CC[C@@H]2[C@]13C[C@H]([C@](O3)(CC2=C)O)C(C)C |