For research use only. Not for therapeutic Use.
Curzerenone(Cat No.:R059861) is a natural compound derived from the root of certain plants. Its mode of action and pharmacological effects involve interactions with cellular processes and molecular targets due to its specific chemical structure. Curzerenone has been investigated for its potential bioactivities, including anti-inflammatory, anti-cancer, and antioxidant properties. It also exhibits potential in modulating cellular signaling pathways. Its applications extend to natural product research and the development of pharmaceuticals, nutraceuticals, and other health-related products, harnessing its potential as a versatile compound with diverse properties.
Catalog Number | R059861 |
CAS Number | 20493-56-5 |
Molecular Formula | C15H18O2 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | (5R,6R)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5,7-dihydro-1-benzofuran-4-one |
InChI | InChI=1S/C15H18O2/c1-6-15(5)7-11-12(10(4)8-17-11)14(16)13(15)9(2)3/h6,8,13H,1-2,7H2,3-5H3/t13-,15-/m0/s1 |
InChIKey | ZVMJXSJCBLRAPD-ZFWWWQNUSA-N |
SMILES | CC1=COC2=C1C(=O)[C@@H]([C@@](C2)(C)C=C)C(=C)C |