For research use only. Not for therapeutic Use.
CX546（Cat No.:I002654） is a representative ampakine compound known for its selective positive modulation of AMPA receptors. As a positive modulator, it enhances the activity of AMPA receptors, which are important for synaptic transmission and plasticity in the brain. By increasing the activity of these receptors, CX546 can enhance excitatory neurotransmission and potentially improve cognitive functions.
| Catalog Number | I002654 |
| CAS Number | 215923-54-9 |
| Synonyms | (2,3-dihydrobenzo[b][1,4]dioxin-6-yl)(piperidin-1-yl)methanone |
| Molecular Formula | C14H17NO3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | 100 mM in DMSO； 100 mM in ethanol； |
| Storage | 2-8°C |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl(piperidin-1-yl)methanone |
| InChI | InChI=1S/C14H17NO3/c16-14(15-6-2-1-3-7-15)11-4-5-12-13(10-11)18-9-8-17-12/h4-5,10H,1-3,6-9H2 |
| InChIKey | LJUNPHMOGNFFOS-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC3=C(C=C2)OCCO3 |
