For research use only. Not for therapeutic Use.
CXCR2 antagonist 8(Cat No.:I042916)is a synthetic compound designed to block the CXCR2 receptor, a G protein-coupled receptor involved in inflammatory responses. By inhibiting CXCR2, which plays a crucial role in recruiting immune cells to sites of inflammation, this antagonist has potential therapeutic applications in treating inflammatory diseases, such as rheumatoid arthritis, asthma, and chronic obstructive pulmonary disease (COPD). Research is ongoing to explore its effectiveness in reducing inflammation and managing conditions driven by immune cell migration. CXCR2 antagonist 8 offers a promising approach for modulating the immune system to treat various inflammatory disorders.
CAS Number | 182498-30-2 |
Synonyms | 1-(2-hydroxy-4-nitrophenyl)-3-(2-methoxyphenyl)urea |
Molecular Formula | C14H13N3O5 |
Purity | ≥95% |
IUPAC Name | 1-(2-hydroxy-4-nitrophenyl)-3-(2-methoxyphenyl)urea |
InChI | InChI=1S/C14H13N3O5/c1-22-13-5-3-2-4-11(13)16-14(19)15-10-7-6-9(17(20)21)8-12(10)18/h2-8,18H,1H3,(H2,15,16,19) |
InChIKey | KNPLCJZGNRGZAN-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1NC(=O)NC2=C(C=C(C=C2)[N+](=O)[O-])O |