For research use only. Not for therapeutic Use.
Cy7 dyes are widely used for labeling peptides, proteins and oligos etc. Cy7 dye conjugates are one type of the most common near infrared red fluorophores used in in vivo imaging applications.
Excitation (nm): 749, Emission (nm): 767
| Catalog Number | I013803 |
| CAS Number | 943298-08-6 |
| Molecular Formula | C₃₅H₄₂N₂O₈S₂ |
| Purity | ≥95% |
| Target | Dye Reagents |
| Solubility | DMSO: ≥ 33 mg/mL |
| IUPAC Name | (2Z)-2-[(2E,4E,6E)-7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]hepta-2,4,6-trienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate |
| InChI | InChI=1S/C35H42N2O8S2/c1-6-36-29-20-18-25(46(40,41)42)23-27(29)34(2,3)31(36)15-11-8-7-9-12-16-32-35(4,5)28-24-26(47(43,44)45)19-21-30(28)37(32)22-14-10-13-17-33(38)39/h7-9,11-12,15-16,18-21,23-24H,6,10,13-14,17,22H2,1-5H3,(H2-,38,39,40,41,42,43,44,45) |
| InChIKey | CZWUESRDTYLNDE-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)S(=O)(=O)[O-])C(C1=CC=CC=CC=CC3=[N+](C4=C(C3(C)C)C=C(C=C4)S(=O)(=O)O)CCCCCC(=O)O)(C)C |
