For research use only. Not for therapeutic Use.
Cyanidin 3-xyloside is a naturally occurring anthocyanin found in various fruits and vegetables. This compound consists of the anthocyanidin cyanidin linked to a xylose sugar molecule at the 3-position. It exhibits potent antioxidant and anti-inflammatory properties, contributing to its potential health benefits, including cardiovascular protection and anti-cancer effects. Research on cyanidin 3-xyloside focuses on its bioavailability, mechanisms of action, and potential therapeutic applications in promoting health and preventing chronic diseases.
Catalog Number | R047914 |
CAS Number | 29761-24-8 |
Synonyms | 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-(D-xylopyranosyloxy)-1-benzopyrylium Chloride; |
Molecular Formula | C20H19ClO10 |
Purity | ≥95% |
Storage | -20 °C |
IUPAC Name | (4S,5R)-2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxyoxane-3,4,5-triol;chloride |
InChI | InChI=1S/C20H18O10.ClH/c21-9-4-12(23)10-6-16(30-20-18(27)17(26)14(25)7-28-20)19(29-15(10)5-9)8-1-2-11(22)13(24)3-8;/h1-6,14,17-18,20,25-27H,7H2,(H3-,21,22,23,24);1H/t14-,17+,18,20;/m1./s1 |
InChIKey | ORTBMTXABUAMJS-CRTITRSXSA-N |
SMILES | C1C(C(C(C(O1)OC2=C([O+]=C3C=C(C=C(C3=C2)O)O)C4=CC(=C(C=C4)O)O)O)O)O.[Cl-] |