For research use only. Not for therapeutic Use.
Cyanoacrylic acid（Cat No.:M083774） is a potent chemical compound characterized by the presence of both a cyano group (-CN) and a carboxylic acid group (-COOH) attached to an acrylic backbone. This structure makes it a key intermediate in the synthesis of cyanoacrylate adhesives, commonly known as superglues. The cyano group enhances the adhesive’s rapid polymerization and strong bonding capabilities upon exposure to moisture. Cyanoacrylic acid is pivotal in the manufacturing process of these adhesives, which are widely used in various applications, including medical, automotive, and household settings for their fast-setting and durable bonding properties.
| Catalog Number | M083774 |
| CAS Number | 15802-18-3 |
| Molecular Formula | C4H3NO2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 2-cyanoprop-2-enoic acid |
| InChI | InChI=1S/C4H3NO2/c1-3(2-5)4(6)7/h1H2,(H,6,7) |
| InChIKey | IJVRPNIWWODHHA-UHFFFAOYSA-N |
| SMILES | C=C(C#N)C(=O)O |
