Home
>
Chemical Reagents>Heterocyclic Building Blocks> Cyanomethyl 3,5-dimethyl-1H-pyrazole-1-carbodithioate
For research use only. Not for therapeutic Use.
Cyanomethyl 3,5-dimethyl-1H-pyrazole-1-carbodithioate(CAT: L000073) is a significant compound in the field of organic chemistry and materials science. This chemical structure consists of a pyrazole ring with a cyanomethyl carbodithioate moiety, and it is widely used as a key intermediate for the synthesis of organic molecules with diverse applications. Its unique structure allows for versatile reactivity, making it valuable in the design of advanced materials and specialty polymers.
CAS Number | 1823403-92-4 |
Molecular Formula | C8H9N3S2 |
Purity | ≥95% |
IUPAC Name | cyanomethyl 3,5-dimethylpyrazole-1-carbodithioate |
InChI | InChI=1S/C8H9N3S2/c1-6-5-7(2)11(10-6)8(12)13-4-3-9/h5H,4H2,1-2H3 |
InChIKey | OMTFYPHYESIDFH-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |