For research use only. Not for therapeutic Use.
Cyclacillin（Cat No.:I006332）is a synthetic β-lactam antibiotic that belongs to the penicillin family. It works by inhibiting bacterial cell wall synthesis, leading to the disruption of bacterial growth and reproduction. Cyclacillin is primarily used to treat infections caused by Gram-positive and Gram-negative bacteria, including those responsible for respiratory, urinary tract, and skin infections. It has a similar mechanism of action to other penicillin derivatives but with enhanced stability in the presence of bacterial β-lactamases, making it effective against some resistant strains. Cyclacillin is commonly utilized in clinical settings for infection management and bacterial eradication.
| CAS Number | 3485-14-1 |
| Synonyms | (2S,5R,6R)-6-[(1-aminocyclohexanecarbonyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Molecular Formula | C15H23N3O4S |
| Purity | ≥95% |
| IUPAC Name | (2S,5R,6R)-6-[(1-aminocyclohexanecarbonyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChI | InChI=1S/C15H23N3O4S/c1-14(2)9(12(20)21)18-10(19)8(11(18)23-14)17-13(22)15(16)6-4-3-5-7-15/h8-9,11H,3-7,16H2,1-2H3,(H,17,22)(H,20,21)/t8-,9+,11-/m1/s1 |
| InChIKey | HGBLNBBNRORJKI-WCABBAIRSA-N |
| SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)C3(CCCCC3)N)C(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
