For research use only. Not for therapeutic Use.
Selective, ATP-competitive polo-like kinase 1 (PLK1) inhibitor (IC<sub>50</sub> = 500 nM).
| Catalog Number | I010704 |
| CAS Number | 40533-25-3 |
| Synonyms | 7-Nitro-5-(trifluoromethyl)-2-benzothiazolecarboxamide-3-oxide |
| Molecular Formula | C9H4F3N3O4S |
| Purity | ≥95% |
| Target | Polo-like Kinase (PLK) |
| Solubility | Soluble to 25 mM in DMSO and to 10 mM in ethanol |
| Storage | Desiccate at +4C |
| IUPAC Name | 7-nitro-3-oxido-5-(trifluoromethyl)-1,3-benzothiazol-3-ium-2-carboxamide |
| InChI | InChI=1S/C9H4F3N3O4S/c10-9(11,12)3-1-4-6(5(2-3)15(18)19)20-8(7(13)16)14(4)17/h1-2H,(H2,13,16) |
| InChIKey | FHFLXKUKCSDMLD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1[N+](=C(S2)C(=O)N)[O-])[N+](=O)[O-])C(F)(F)F |
