For research use only. Not for therapeutic Use.
Cycleanine(CAT: R072462) is a chemical compound belonging to the quinoline alkaloids family. It is derived from certain plant sources and possesses interesting biological properties. Cycleanine has been studied for its potential pharmacological effects, including its antimicrobial, antiviral, and antioxidant properties. Furthermore, it has shown some potential as a therapeutic agent in traditional medicine systems. Researchers are continuing to explore the compound’s pharmacological activities and potential applications in various fields.
| Catalog Number | R072462 |
| CAS Number | 518-94-5 |
| Molecular Formula | C38H42N2O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C38H42N2O6/c1-39-17-15-25-21-31(41-3)35(43-5)37-33(25)29(39)19-23-7-11-28(12-8-23)46-38-34-26(22-32(42-4)36(38)44-6)16-18-40(2)30(34)20-24-9-13-27(45-37)14-10-24/h7-14,21-22,29-30H,15-20H2,1-6H3/t29-,30-/m1/s1 |
| InChIKey | ANOXEUSGZWSCQL-LOYHVIPDSA-N |
| SMILES | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC=C(O3)C=C7)N(CCC6=CC(=C5OC)OC)C)OC)OC |
