For research use only. Not for therapeutic Use.
Cyclic AMP Sodium (Cat No.:L046955) is a crucial second messenger involved in intracellular signal transduction pathways. It plays a vital role in regulating various physiological processes, including metabolism, cell growth, and hormone response. As a derivative of adenosine triphosphate (ATP), cAMP activates protein kinase A (PKA), which then modulates cellular functions by phosphorylating target proteins. In research, cAMP sodium is used to study signaling mechanisms in processes like hormone action, neurotransmission, and cellular communication. Its sodium salt form enhances solubility, making it ideal for in vitro biochemical and pharmacological studies.
CAS Number | 37839-81-9 |
Molecular Formula | C10H11N5NaO6P |
Purity | ≥95% |
IUPAC Name | sodium;(4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
InChI | InChI=1S/C10H12N5O6P.Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7;/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13);/q;+1/p-1/t4-,6-,7-,10-;/m1./s1 |
InChIKey | BXJBFCKTIWRKMQ-MCDZGGTQSA-M |
SMILES | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(O1)[O-].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |