For research use only. Not for therapeutic Use.
Cyclic GMP sodium(Cat No.:R056883)is a cyclic nucleotide derived from guanosine triphosphate (GTP) that acts as an important intracellular signaling molecule. It plays a crucial role in regulating various physiological processes, including vasodilation, neurotransmission, and cell growth. By activating protein kinases and influencing ion channels, cyclic GMP sodium helps regulate smooth muscle relaxation, blood flow, and the function of various organs. It is involved in signaling pathways related to cardiovascular health, neural activity, and visual processes. In research, cyclic GMP sodium is used to study cellular signaling mechanisms and to explore therapeutic applications in cardiovascular and neurological diseases.
CAS Number | 40732-48-7 |
Synonyms | sodium;9-[(4aR,6R,7aR)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
Molecular Formula | C10H11N5NaO7P |
Purity | ≥95% |
IUPAC Name | sodium;9-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
InChI | InChI=1S/C10H12N5O7P.Na/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6;/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17);/q;+1/p-1/t3-,5-,6-,9-;/m1./s1 |
InChIKey | KMPIYXNEROUNOG-GWTDSMLYSA-M |
SMILES | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C3N=C(NC4=O)N)O)OP(=O)(O1)[O-].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |