For research use only. Not for therapeutic Use.
Cyclo(phenylalanyl-phenylalanyl) (CAT: R074524) is a cyclic dipeptide composed of two phenylalanine amino acid residues. This type of compound is often encountered in peptide chemistry and can be found as a structural element in larger peptides and proteins. The specific characteristics and uses of Cyclo(phenylalanyl-phenylalanyl) can vary depending on its context within a larger molecule or its role in peptide research.
CAS Number | 2862-51-3 |
Molecular Formula | C18H18N2O2 |
Purity | 95% |
Appearance | White solid |
Analysis method | HPLC |
IUPAC Name | (3S,6S)-3,6-dibenzylpiperazine-2,5-dione |
InChI | InChI=1S/C18H18N2O2/c21-17-15(11-13-7-3-1-4-8-13)19-18(22)16(20-17)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,22)(H,20,21)/t15-,16-/m0/s1 |
InChIKey | JUAPMRSLDANLAS-HOTGVXAUSA-N |
SMILES | C1=CC=C(C=C1)CC2C(=O)NC(C(=O)N2)CC3=CC=CC=C3 |
Reference | 1. Biochemistry of microorganisms. CXI. The production of L-phenylalanine anhydride (cis-L-3,6-dibenzyl-2,5- |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |