For research use only. Not for therapeutic Use.
Cyclo(RADfK)(CAT: I004802) is a cyclic pentapeptide that serves as a potent and selective ligand for integrins, particularly αvβ3. This peptide is widely used in research exploring cell adhesion, angiogenesis, and cancer metastasis, as integrins play crucial roles in these processes. Its cyclic structure enhances binding affinity and stability, making it a reliable tool for studying integrin-related signaling pathways. Cyclo(RADfK) is ideal for investigating tumor growth, angiogenic mechanisms, and potential therapeutic strategies targeting integrin-mediated interactions in various diseases. Its high purity and consistent performance ensure reproducible and accurate results in biochemical and cellular studies.
CAS Number | 756500-23-9 |
Molecular Formula | C28H43N9O7 |
Purity | ≥95% |
Target | Integrin |
Solubility | 10 mM in DMSO |
Storage | Store at 4°C |
IUPAC Name | 2-[(2S,5R,8S,11S,14S)-8-(4-aminobutyl)-5-benzyl-11-[3-(diaminomethylideneamino)propyl]-14-methyl-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]acetic acid |
InChI | InChI=1S/C28H43N9O7/c1-16-23(40)36-21(15-22(38)39)27(44)37-20(14-17-8-3-2-4-9-17)26(43)35-18(10-5-6-12-29)25(42)34-19(24(41)33-16)11-7-13-32-28(30)31/h2-4,8-9,16,18-21H,5-7,10-15,29H2,1H3,(H,33,41)(H,34,42)(H,35,43)(H,36,40)(H,37,44)(H,38,39)(H4,30,31,32)/t16-,18-,19-,20+,21-/m0/s1 |
InChIKey | SMFHXHGBDFBWOX-BWUHRYBWSA-N |
SMILES | C[C@H]1C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)CCCN=C(N)N)CCCCN)CC2=CC=CC=C2)CC(=O)O |