For research use only. Not for therapeutic Use.
Cyclo(-RGDfK)(CAT: I002058) is a potent and selective inhibitor of the αvβ3 integrin. It belongs to the RGD (Arg-Gly-Asp) peptide family, which specifically interacts with integrins. The αvβ3 integrin is a cell surface receptor that plays a crucial role in processes such as cell adhesion, migration, and angiogenesis. By blocking the αvβ3 integrin, cyclo(-RGDfK) can inhibit these processes and has shown potential in various preclinical and clinical studies as a therapeutic agent for conditions involving angiogenesis, such as cancer and certain vascular diseases.
| Catalog Number | I002058 |
| CAS Number | 161552-03-0 |
| Synonyms | 2-[(2S,5R,8S,11S)-8-(4-aminobutyl)-5-benzyl-11-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]acetic acid |
| Molecular Formula | C27H41N9O7 |
| Purity | ≥95% |
| Target | Integrin |
| Solubility | DMSO: 41mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 2-[(2S,5R,8S,11S)-8-(4-aminobutyl)-5-benzyl-11-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]acetic acid |
| InChI | InChI=1S/C27H41N9O7/c28-11-5-4-9-18-24(41)34-17(10-6-12-31-27(29)30)23(40)32-15-21(37)33-20(14-22(38)39)26(43)36-19(25(42)35-18)13-16-7-2-1-3-8-16/h1-3,7-8,17-20H,4-6,9-15,28H2,(H,32,40)(H,33,37)(H,34,41)(H,35,42)(H,36,43)(H,38,39)(H4,29,30,31)/t17-,18-,19+,20-/m0/s1 |
| InChIKey | NVHPXYIRNJFKTE-HAGHYFMRSA-N |
| SMILES | C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCN=C(N)N)CCCCN)CC2=CC=CC=C2)CC(=O)O |
| Reference | <p style=”/line-height:25px/”> |
