For research use only. Not for therapeutic Use.
Cyclobenzaprine(CAT: I006334) is a centrally acting muscle relaxant that functions by modulating the activity of motor neurons in the central nervous system. Structurally related to tricyclic antidepressants, it exhibits anticholinergic and sedative properties. Cyclobenzaprine is primarily used in research to study its effects on neuromuscular transmission and muscle spasm relief. Its mechanism involves reducing tonic somatic motor activity at the brainstem level, which leads to diminished muscle hyperactivity. Cyclobenzaprine is a valuable compound in the exploration of neuromuscular disorders, pain management, and the development of therapeutics targeting muscle spasticity and related conditions.
CAS Number | 303-53-7 |
Synonyms | Flexeril; Proheptatriene; Lisseril; Proeptatriene; Proheptatrien;3-(dibenzo[1,2-a:1/’,2/’-e][7]annulen-11-ylidene)-N,N-dimethylpropan-1-amine |
Molecular Formula | C20H21N |
Purity | ≥95% |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4°C for short term ,or -20 °C for long term |
IUPAC Name | N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine |
InChI | InChI=1S/C20H21N/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20/h3-6,8-14H,7,15H2,1-2H3 |
InChIKey | JURKNVYFZMSNLP-UHFFFAOYSA-N |
SMILES | CN(C)CCC=C1C2=CC=CC=C2C=CC3=CC=CC=C31 |