For research use only. Not for therapeutic Use.
Cyclocreatine is a synthetic analog of creatine, a compound naturally involved in energy storage and release in cells, particularly in muscle tissue. Cyclocreatine is structurally similar to creatine but features a cyclized phosphate group, which allows it to be taken up by cells and stored as phosphocreatine. It plays a role in buffering cellular ATP levels, aiding in energy production. Cyclocreatine has been studied for its potential in treating energy-depletion conditions, such as muscular dystrophy and certain cancers, by enhancing cellular energy reserves. It has also shown promise as an anticancer agent due to its ability to interfere with tumor cell metabolism.
CAS Number | 35404-50-3 |
Synonyms | 2-Amino-4,5-dihydro-1H-Imidazole-1-acetic Acid; 1-Carboxymethyl-2-iminoimidazolidine; |
Molecular Formula | C5H9N3O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid |
InChI | InChI=1S/C5H9N3O2/c6-5-7-1-2-8(5)3-4(9)10/h1-3H2,(H2,6,7)(H,9,10) |
InChIKey | AMHZIUVRYRVYBA-UHFFFAOYSA-N |
SMILES | C1CN(C(=N1)N)CC(=O)O |