For research use only. Not for therapeutic Use.
Cyclocurcumin（Cat No.:M095071）is a naturally occurring derivative of curcumin, the active compound in turmeric. It is formed through the cyclization of curcumin’s structure, resulting in a cyclic compound with enhanced stability and bioactivity. Cyclocurcumin has been studied for its potent anti-inflammatory, antioxidant, and anticancer properties. It is believed to be more stable than curcumin, making it a promising candidate for therapeutic applications. Research suggests it may offer benefits in treating diseases associated with oxidative stress and inflammation, including cancer, cardiovascular diseases, and neurodegenerative conditions, while also exhibiting potential antimicrobial effects.
| CAS Number | 153127-42-5 |
| Synonyms | 2-(4-hydroxy-3-methoxyphenyl)-6-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-2,3-dihydropyran-4-one |
| Molecular Formula | C21H20O6 |
| Purity | ≥95% |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-6-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-2,3-dihydropyran-4-one |
| InChI | InChI=1S/C21H20O6/c1-25-20-9-13(4-7-17(20)23)3-6-16-11-15(22)12-19(27-16)14-5-8-18(24)21(10-14)26-2/h3-11,19,23-24H,12H2,1-2H3/b6-3+ |
| InChIKey | IZLBLUIBVMGMIY-ZZXKWVIFSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C2=CC(=O)CC(O2)C3=CC(=C(C=C3)O)OC)O |
