For research use only. Not for therapeutic Use.
Cyclofenil (Cat.No:R050994) is a nonsteroidal compound with estrogenic properties. It was initially developed as a fertility-enhancing drug due to its ability to stimulate ovulation. However, its use has diminished over time, and it is now mainly of historical interest in the context of reproductive medicine.
| Catalog Number | R050994 |
| CAS Number | 2624-43-3 |
| Synonyms | 4,4’-(Cyclohexylidenemethylene)bisphenol 1,1’-Diacetate; 4,4’-(Cyclohexylide?nemethylene)diphenol Diacetate Ester; Bis(p-acetoxyphenyl)cyclohexylidenemethane; Cyclofenyl; Cyclopenil; Cyclophenyl; F 6066; Fertodur; H 3452; ICI 48213; NSC 86464; Neocly |
| Molecular Formula | C23H24O4 |
| Purity | ≥95% |
| Target | Estrogen/progestogen Receptor |
| Solubility | Limited solubility |
| Storage | Store at +4C |
| IUPAC Name | [4-[(4-acetyloxyphenyl)-cyclohexylidenemethyl]phenyl] acetate |
| InChI | InChI=1S/C23H24O4/c1-16(24)26-21-12-8-19(9-13-21)23(18-6-4-3-5-7-18)20-10-14-22(15-11-20)27-17(2)25/h8-15H,3-7H2,1-2H3 |
| InChIKey | GVOUFPWUYJWQSK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(=C2CCCCC2)C3=CC=C(C=C3)OC(=O)C |
