For research use only. Not for therapeutic Use.
Cyclofenil (Cat.No:R050994) is a nonsteroidal compound with estrogenic properties. It was initially developed as a fertility-enhancing drug due to its ability to stimulate ovulation. However, its use has diminished over time, and it is now mainly of historical interest in the context of reproductive medicine.
CAS Number | 2624-43-3 |
Synonyms | 4,4’-(Cyclohexylidenemethylene)bisphenol 1,1’-Diacetate; 4,4’-(Cyclohexylide?nemethylene)diphenol Diacetate Ester; Bis(p-acetoxyphenyl)cyclohexylidenemethane; Cyclofenyl; Cyclopenil; Cyclophenyl; F 6066; Fertodur; H 3452; ICI 48213; NSC 86464; Neocly |
Molecular Formula | C23H24O4 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | Limited solubility |
Storage | Store at +4C |
IUPAC Name | [4-[(4-acetyloxyphenyl)-cyclohexylidenemethyl]phenyl] acetate |
InChI | InChI=1S/C23H24O4/c1-16(24)26-21-12-8-19(9-13-21)23(18-6-4-3-5-7-18)20-10-14-22(15-11-20)27-17(2)25/h8-15H,3-7H2,1-2H3 |
InChIKey | GVOUFPWUYJWQSK-UHFFFAOYSA-N |
SMILES | CC(=O)OC1=CC=C(C=C1)C(=C2CCCCC2)C3=CC=C(C=C3)OC(=O)C |