For research use only. Not for therapeutic Use.
Cycloguanil-d6 is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of Cycloguanil, featuring six deuterium atoms, is crucial for studies involving antimalarial drug metabolism, pharmacokinetics, and drug interaction analysis. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for antimalarial research and drug development, Cycloguanil-d6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000952 |
| Molecular Formula | C11H8D6ClN5 |
| Purity | ≥95% |
| IUPAC Name | 1-(4-chlorophenyl)-6,6-bis(trideuteriomethyl)-1,3,5-triazine-2,4-diamine |
| InChI | InChI=1S/C11H14ClN5/c1-11(2)16-9(13)15-10(14)17(11)8-5-3-7(12)4-6-8/h3-6H,1-2H3,(H4,13,14,15,16)/i1D3,2D3 |
| InChIKey | QMNFFXRFOJIOKZ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1(N=C(N=C(N1C2=CC=C(C=C2)Cl)N)N)C([2H])([2H])[2H] |
