For research use only. Not for therapeutic Use.
Cycloguanil pamoate (Cat. No: I006335) is an antimalarial compound that acts as a prodrug of cycloguanil, a potent dihydrofolate reductase (DHFR) inhibitor. It disrupts the folate pathway in malaria parasites, inhibiting DNA synthesis and cell replication, ultimately leading to the parasite’s death. Cycloguanil Pamoate is studied for its long-acting properties and potential in the prevention and treatment of malaria, particularly in combination therapies. Its sustained-release formulation makes it valuable for prolonged therapeutic effects, and it plays an important role in research aimed at combating drug-resistant strains of Plasmodium species, offering insights into more effective malaria treatments.
CAS Number | 609-78-9 |
Synonyms | Cycloguanil pamoate; Cycloguanil embonate; C11724; D02387.;2-Naphthalenecarboxylic acid, 4,4/’-methylenebis(3-hydroxy-, compd. with 1-(4-chlorophenyl)-1,6-dihydro-6,6-dimethyl-1,3,5-triazine-2,4-diamine (1:2) |
Molecular Formula | C45H44Cl2N10O6 |
Purity | ≥95% |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4°C for short term ,or -20 °C for long term |
IUPAC Name | 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid;1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
InChI | InChI=1S/C23H16O6.2C11H14ClN5/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;2*1-11(2)16-9(13)15-10(14)17(11)8-5-3-7(12)4-6-8/h1-10,24-25H,11H2,(H,26,27)(H,28,29);2*3-6H,1-2H3,(H4,13,14,15,16) |
InChIKey | LUNRMKZYOGNOTR-UHFFFAOYSA-N |
SMILES | CC1(N=C(N=C(N1C2=CC=C(C=C2)Cl)N)N)C.CC1(N=C(N=C(N1C2=CC=C(C=C2)Cl)N)N)C.C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)O)O)C(=O)O |