For research use only. Not for therapeutic Use.
Cyclohexane-1,4-dicarbaldehyde(Cat No.:L037933)is an aliphatic compound featuring two aldehyde groups attached to a cyclohexane ring at the 1 and 4 positions. This molecule is widely used as an intermediate in organic synthesis, particularly in the creation of polymers, pharmaceuticals, and complex chemical structures. Its symmetrical structure and reactivity make it ideal for developing novel materials and bioactive compounds. With high purity and stability, Cyclohexane-1,4-dicarbaldehyde plays a crucial role in various chemical research and industrial applications, offering reliable performance in diverse synthesis processes.
CAS Number | 33424-83-8 |
Molecular Formula | C8H12O2 |
Purity | ≥95% |
IUPAC Name | cyclohexane-1,4-dicarbaldehyde |
InChI | InChI=1S/C8H12O2/c9-5-7-1-2-8(6-10)4-3-7/h5-8H,1-4H2 |
InChIKey | QWKLKVRIQGSSKF-UHFFFAOYSA-N |
SMILES | C1CC(CCC1C=O)C=O |