For research use only. Not for therapeutic Use.
Cyclohexanecarboxylic acid-d11(Cat No.:R019353)is a deuterated form of cyclohexanecarboxylic acid, where eleven hydrogen atoms are replaced with deuterium, a stable isotope of hydrogen. This isotopic substitution is commonly used in NMR (Nuclear Magnetic Resonance) spectroscopy, reducing interference from protons and providing clearer, more accurate spectral data. Cyclohexanecarboxylic acid-d11 is useful in studying the structural and dynamic properties of cyclohexane derivatives, aiding in organic synthesis, drug development, and the analysis of molecular behavior. Its deuterated form is valuable in isotopic labeling experiments, helping to explore reaction mechanisms and chemical interactions.
CAS Number | 93131-16-9 |
Synonyms | 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carboxylic acid |
Molecular Formula | C7HD11O2 |
Purity | ≥95% |
IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carboxylic acid |
InChI | InChI=1S/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9)/i1D2,2D2,3D2,4D2,5D2,6D |
InChIKey | NZNMSOFKMUBTKW-KAFHOZLVSA-N |
SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C(=O)O)([2H])[2H])([2H])[2H])[2H] |