For research use only. Not for therapeutic Use.
Cyclohexanedimethanol divinyl ether(Cat No.:M086561) is a specialized organic compound characterized by its two vinyl ether groups attached to a cyclohexane ring. This structure includes a cyclohexane backbone with two methanol groups, each further modified with a vinyl ether function. The chemical is primarily used in the production of polymers and co-polymers due to its ability to undergo radical polymerization. Its inclusion in polymer formulations enhances the flexibility, durability, and chemical resistance of the final products.
CAS Number | 17351-75-6 |
Molecular Formula | C12H20O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,4-bis(ethenoxymethyl)cyclohexane |
InChI | InChI=1S/C12H20O2/c1-3-13-9-11-5-7-12(8-6-11)10-14-4-2/h3-4,11-12H,1-2,5-10H2 |
InChIKey | DQNSRQYYCSXZDF-UHFFFAOYSA-N |
SMILES | C=COCC1CCC(CC1)COC=C |