For research use only. Not for therapeutic Use.
Cyclohexanesulfinic acid sodium salt（Cat No.:L007701）, is a chemical compound comprising a sodium salt of cyclohexanesulfinic acid. This specific compound is utilized in various chemical processes and industrial applications. It acts as a reducing agent, finding use in the reduction of various organic and inorganic compounds. Additionally, it serves as a stabilizing agent in the production of polymers and as a corrosion inhibitor in metalworking fluids. Its applications extend to fields like pharmaceuticals, textiles, and surface coatings. The compound’s reducing properties and stability make it valuable in industrial processes, contributing to advancements in chemical manufacturing and related industries.
| Catalog Number | L007701 |
| CAS Number | 74829-95-1 |
| Molecular Formula | C6H11NaO2S |
| Purity | ≥95% |
| IUPAC Name | sodium;cyclohexanesulfinate |
| InChI | InChI=1S/C6H12O2S.Na/c7-9(8)6-4-2-1-3-5-6;/h6H,1-5H2,(H,7,8);/q;+1/p-1 |
| InChIKey | VKOSCBDFLPBMCB-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)S(=O)[O-].[Na+] |
