For research use only. Not for therapeutic Use.
Cyclohexanone, 3-ethoxy- (8CI,9CI)(Cat No.:M060695) is a chemical compound where an ethoxy group is attached to the cyclohexanone ring, specifically at the third position. Cyclohexanone is a six-carbon cyclic ketone, and the addition of an ethoxy group introduces ether-like properties. This modification impacts the compound’s solubility and reactivity, making it useful in various chemical synthesis processes. 3-Ethoxycyclohexanone is employed as an intermediate in the production of pharmaceuticals and fine chemicals, offering unique functionalities needed in complex synthesis pathways. Its properties also make it a candidate for studies in organic synthesis and potential applications in material science.
CAS Number | 13619-73-3 |
Synonyms | Cyclohexanone, 3-ethoxy- (8CI,9CI) |
Molecular Formula | C8H14O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 3-ethoxycyclohexan-1-one |
InChI | InChI=1S/C8H14O2/c1-2-10-8-5-3-4-7(9)6-8/h8H,2-6H2,1H3 |
InChIKey | PKYLKBLJFGCIGT-UHFFFAOYSA-N |
SMILES | CCOC1CCCC(=O)C1 |