For research use only. Not for therapeutic Use.
Cyclo(L-Phe-L-Val)(Cat No.:R071864)is a cyclic dipeptide composed of phenylalanine (L-Phe) and valine (L-Val) amino acids. It is a synthetic compound often used in biochemical and pharmacological research to study peptide-based drug delivery systems, protein interactions, and enzyme modulation. The cyclic structure enhances the stability and bioactivity of the peptide, making it a valuable tool in drug design, particularly in the development of peptide-based therapeutics. Cyclo(L-Phe-L-Val) has shown promise in modulating various biological pathways, and ongoing research is exploring its potential applications in treating inflammatory diseases, cancer, and other conditions.
CAS Number | 35590-86-4 |
Synonyms | (3S,6S)-3-benzyl-6-propan-2-ylpiperazine-2,5-dione |
Molecular Formula | C14H18N2O2 |
Purity | ≥95% |
IUPAC Name | (3S,6S)-3-benzyl-6-propan-2-ylpiperazine-2,5-dione |
InChI | InChI=1S/C14H18N2O2/c1-9(2)12-14(18)15-11(13(17)16-12)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3,(H,15,18)(H,16,17)/t11-,12-/m0/s1 |
InChIKey | OQQPOHUVAQPSHJ-RYUDHWBXSA-N |
SMILES | CC(C)[C@H]1C(=O)N[C@H](C(=O)N1)CC2=CC=CC=C2 |