For research use only. Not for therapeutic Use.
Cyclooctyne-O-PFP ester（Cat No.:I017849） is a cleavable linker used in the synthesis of antibody-drug conjugates (ADCs). This linker provides a stable connection between the antibody and the attached drug payload, facilitating selective delivery of the drug to target cells. The ester bond in Cyclooctyne-O-PFP ester can be cleaved under specific conditions, allowing for the release of the drug within the target cells. This linker design contributes to the development of effective ADCs, enabling targeted drug delivery and potentially enhancing therapeutic outcomes.
| Catalog Number | I017849 |
| CAS Number | 886209-60-5 |
| Molecular Formula | C₁₆H₁₃F₅O₃ |
| Purity | ≥95% |
| Target | ADC Linker |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-cyclooct-2-yn-1-yloxyacetate |
| InChI | InChI=1S/C16H13F5O3/c17-11-12(18)14(20)16(15(21)13(11)19)24-10(22)8-23-9-6-4-2-1-3-5-7-9/h9H,1-4,6,8H2 |
| InChIKey | FTKRNGMQMZGSDF-UHFFFAOYSA-N |
| SMILES | C1CCC#CC(CC1)OCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
| Reference | [1]. Sun, Ying, et al. Anti-PSMA Antibodies Conjugated to Nuclear Receptor Ligand Polypeptides. 20150152187A1. |
