For research use only. Not for therapeutic Use.
Cyclopentane-1,1-diacetic acid is a cyclic dicarboxylic acid used as a versatile intermediate in organic synthesis and pharmaceutical research. Its cyclopentane core, combined with two acetic acid groups, allows for easy functionalization and chemical modifications, making it useful in the development of bioactive compounds and drug candidates. This compound is also employed in the synthesis of complex molecules and specialized materials. Its structural features contribute to advancements in medicinal chemistry and other fields of molecular research.
CAS Number | 16713-66-9 |
Molecular Formula | C9H14O4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-[1-(carboxymethyl)cyclopentyl]acetic acid |
InChI | InChI=1S/C9H14O4/c10-7(11)5-9(6-8(12)13)3-1-2-4-9/h1-6H2,(H,10,11)(H,12,13) |
InChIKey | FWPVKDFOUXHOKQ-UHFFFAOYSA-N |
SMILES | C1CCC(C1)(CC(=O)O)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |