For research use only. Not for therapeutic Use.
Cyclopentenylcytosine is a nucleoside analog with potential antiviral and anticancer properties. It inhibits the enzyme CTP synthetase, disrupting nucleic acid synthesis and cellular metabolism. This compound is significant in pharmaceutical research for developing treatments against viral infections and certain cancers, offering insights into novel therapeutic mechanisms and contributing to advancements in medicinal chemistry.
CAS Number | 90597-22-1 |
Synonyms | 4-Amino-1-[(1R,4R,5S)-4,5-dihydroxy-3-(hydroxymethyl)-2-cyclopenten-1-yl]-2(1H)-pyrimidinone; [1R-(1α,4β,5β)]-4-Amino-1-[4,5-dihydroxy-3-(hydroxymethyl)-2-cyclopenten-1-yl]-2(1H)-pyrimidinone; CPEC; NSC 375575? |
Molecular Formula | C10H13N3O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-amino-1-[(1R,4R,5S)-4,5-dihydroxy-3-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidin-2-one |
InChI | InChI=1S/C10H13N3O4/c11-7-1-2-13(10(17)12-7)6-3-5(4-14)8(15)9(6)16/h1-3,6,8-9,14-16H,4H2,(H2,11,12,17)/t6-,8-,9+/m1/s1 |
InChIKey | DUJGMZAICVPCBJ-VDAHYXPESA-N |
SMILES | C1=CN(C(=O)N=C1N)C2C=C(C(C2O)O)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |