For research use only. Not for therapeutic Use.
Cyclopenthiazide is a thiazide diuretic commonly used to manage hypertension and edema associated with various conditions, such as heart failure and renal disorders. This compound works by inhibiting sodium reabsorption in the distal convoluted tubule of the kidneys, promoting the excretion of sodium and water. Its efficacy in lowering blood pressure makes it a valuable therapeutic agent in cardiovascular medicine. Additionally, cyclopenthiazide is often studied for its potential interactions with other medications and its long-term effects on kidney function.
CAS Number | 742-20-1 |
Synonyms | 6-Chloro-3-(cyclopentylmethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-Dioxide; Benesal; Ciba 8341-Su; Cyclomethiazide; Cyclometiazid; Cyclopentiazid; NSC 107679; Navidreks; Navidrex; Navidrix; Salimed; Salimid; Salurilo-C; Su 8341; 6 |
Molecular Formula | C13H18ClN3O4S2 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 6-chloro-3-(cyclopentylmethyl)-1,1-dioxo-3,4-dihydro-2H-1$l^{6} |
InChI | InChI=1S/C13H18ClN3O4S2/c14-9-6-10-12(7-11(9)22(15,18)19)23(20,21)17-13(16-10)5-8-3-1-2-4-8/h6-8,13,16-17H,1-5H2,(H2,15,18,19) |
InChIKey | BKYKPTRYDKTTJY-UHFFFAOYSA-N |
SMILES | C1CCC(C1)CC2NC3=CC(=C(C=C3S(=O)(=O)N2)S(=O)(=O)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |