For research use only. Not for therapeutic Use.
Cyclophellitol(Cat No.:M117035) is a potent inhibitor of glycoside hydrolase enzymes, particularly retaining β-glucosidases. This compound is structurally similar to the natural substrates of these enzymes, allowing it to bind tightly and inhibit their activity. Cyclophellitol’s inhibitory properties make it a valuable tool in studying the roles of glycoside hydrolases in various biological processes, including carbohydrate metabolism and cell signaling. Its specificity and high affinity for β-glucosidases make it a promising candidate for therapeutic applications, particularly in the treatment of diseases involving dysregulated glycoside hydrolase activity, such as cancer and certain genetic disorders.
CAS Number | 126661-83-4 |
Molecular Formula | C7H12O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (1S,2R,3S,4R,5R,6R)-5-(hydroxymethyl)-7-oxabicyclo[4.1.0]heptane-2,3,4-triol |
InChI | InChI=1S/C7H12O5/c8-1-2-3(9)4(10)5(11)7-6(2)12-7/h2-11H,1H2/t2-,3-,4+,5-,6-,7+/m1/s1 |
InChIKey | YQLWKYQDOQEWRD-GEGSFZHJSA-N |
SMILES | C(C1C(C(C(C2C1O2)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |