For research use only. Not for therapeutic Use.
Cyclopropane-d5-Carboxylic Acid(Cat No.:M125203) is a high-purity deuterated compound featuring five deuterium atoms, essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of cyclopropane carboxylic acid is crucial for studying metabolic pathways, chemical reactions, and the synthesis of complex molecules. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for applications in NMR spectroscopy, drug development, and environmental studies. The enhanced stability and consistency of Cyclopropane-d5-Carboxylic Acid make it suitable for various experimental setups, providing a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | M125203 |
CAS Number | 1219804-09-7 |
Synonyms | CYCLOPROPANE-D5-CARBOXYLIC ACID |
Molecular Formula | C4H6O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,2,2,3,3-pentadeuteriocyclopropane-1-carboxylic acid |
InChI | InChI=1S/C4H6O2/c5-4(6)3-1-2-3/h3H,1-2H2,(H,5,6)/i1D2,2D2,3D |
InChIKey | YMGUBTXCNDTFJI-UXXIZXEISA-N |
SMILES | [2H]C1(C(C1([2H])C(=O)O)([2H])[2H])[2H] |