For research use only. Not for therapeutic Use.
Cyclopropyl 2,4-difluorophenyl ketone(Cat No.:L027353)is a valuable compound in pharmaceutical research and organic synthesis. Featuring a cyclopropyl group attached to a difluorophenyl ketone moiety, this compound is crucial for developing various bioactive molecules, including potential drug candidates. Its unique structure allows for selective chemical reactions and modifications, making it an essential intermediate in synthesizing complex organic compounds. High purity and stability ensure consistent performance in research applications, supporting advanced medicinal chemistry efforts in drug discovery and the development of innovative therapeutic agents.
CAS Number | 60131-34-2 |
Molecular Formula | C10H8F2O |
Purity | ≥95% |
IUPAC Name | cyclopropyl-(2,4-difluorophenyl)methanone |
InChI | InChI=1S/C10H8F2O/c11-7-3-4-8(9(12)5-7)10(13)6-1-2-6/h3-6H,1-2H2 |
InChIKey | JHKCOBHJTXEYLV-UHFFFAOYSA-N |
SMILES | C1CC1C(=O)C2=C(C=C(C=C2)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |