For research use only. Not for therapeutic Use.
Cyclopropyl(4-nitrophenyl)sulfane(CAT: L028337) is an organosulfur compound widely employed in pharmaceutical and chemical research. Featuring a cyclopropyl group bonded to a 4-nitrophenyl sulfane moiety, this compound serves as a versatile intermediate in the synthesis of bioactive molecules and specialty chemicals. Its unique structural features make it valuable for exploring structure-activity relationships (SAR), particularly in the development of therapeutic agents and agrochemicals. With high purity and reliable performance, Cyclopropyl(4-nitrophenyl)sulfane supports advanced research in medicinal chemistry, synthetic organic chemistry, and materials science.
CAS Number | 851008-48-5 |
Molecular Formula | C9H9NO2S |
Purity | ≥95% |
IUPAC Name | 1-cyclopropylsulfanyl-4-nitrobenzene |
InChI | InChI=1S/C9H9NO2S/c11-10(12)7-1-3-8(4-2-7)13-9-5-6-9/h1-4,9H,5-6H2 |
InChIKey | UELKGKJGKADBOY-UHFFFAOYSA-N |
SMILES | C1CC1SC2=CC=C(C=C2)[N+](=O)[O-] |